Products 1291486-47-9

CAS 1291486-47-9 is the registry number for 1-Ethyl-5-oxopyrrolidine-3-carbonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-ethyl-5-oxopyrrolidine-3-carbonyl chloride (CAS 1291486-47-9) is a chemical compound with the molecular formula C7H10ClNO2 and a molecular weight of 175.61 g/mol. IUPAC name: 1-ethyl-5-oxopyrrolidine-3-carbonyl chloride. InChIKey: NLMGIWPPOHBGLL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10ClNO2
Molecular weight175.61 g/mol
IUPAC name1-ethyl-5-oxopyrrolidine-3-carbonyl chloride
InChIKeyNLMGIWPPOHBGLL-UHFFFAOYSA-N
SMILESCCN1CC(CC1=O)C(=O)Cl

Computed by PubChem (NCBI)