Products 54484-57-0
CAS 54484-57-0 is the registry number for (3Z)-3-(1-aminoethylidenE)-1-chloropentane-2,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-5-chloro-3-ethanimidoyl-4-hydroxypent-3-en-2-one (CAS 54484-57-0) is a chemical compound with the molecular formula C7H10ClNO2 and a molecular weight of 175.61 g/mol. IUPAC name: (E)-5-chloro-3-ethanimidoyl-4-hydroxypent-3-en-2-one. InChIKey: OUQDWBCUKYYGII-ZNAUJEAKSA-N.
| Molecular formula | C7H10ClNO2 |
|---|---|
| Molecular weight | 175.61 g/mol |
| IUPAC name | (E)-5-chloro-3-ethanimidoyl-4-hydroxypent-3-en-2-one |
| InChIKey | OUQDWBCUKYYGII-ZNAUJEAKSA-N |
| SMILES | CC(=N)/C(=C(/CCl)\O)/C(=O)C |
Computed by PubChem (NCBI)