CAS 1291486-73-1 is the registry number for Methyl 4-(4-chlorophenyl)-3-(chlorosulfonyl)thiophene-2-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 4-(4-chlorophenyl)-3-chlorosulfonylthiophene-2-carboxylate (CAS 1291486-73-1) is a chemical compound with the molecular formula C12H8Cl2O4S2 and a molecular weight of 351.2 g/mol. IUPAC name: methyl 4-(4-chlorophenyl)-3-chlorosulfonylthiophene-2-carboxylate. InChIKey: RSZCVQYNVROMAZ-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O4S2 |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | methyl 4-(4-chlorophenyl)-3-chlorosulfonylthiophene-2-carboxylate |
| InChIKey | RSZCVQYNVROMAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CS1)C2=CC=C(C=C2)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)