Products 3406-84-6

CAS 3406-84-6 appears in our catalog under these names: 4,4'-Biphenyldisulfonyl chloride, 97%, 4,4-Biphenyldisulfonyl Chloride, 98%, 4,4'–Biphenyldisulfonyl Chloride, 4,4'-Biphenyldisulfonyl Chloride, >97.0%(T)(qNMR), BIPHENYL-4,4'-DISULFONYL DICHLORIDE, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 25g, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride (CAS 3406-84-6) is a chemical compound with the molecular formula C12H8Cl2O4S2 and a molecular weight of 351.2 g/mol. IUPAC name: 4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride. InChIKey: OTFAWEIFBPUXOH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8Cl2O4S2
Molecular weight351.2 g/mol
IUPAC name4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride
InChIKeyOTFAWEIFBPUXOH-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC=C(C=C2)S(=O)(=O)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)