CAS 1291487-19-8 is the registry number for 1-BOC-4-(2-(4-bromophenyl)-2-oxoethyl)piperazine, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 4-[2-(4-bromophenyl)-2-oxoethyl]piperazine-1-carboxylate (CAS 1291487-19-8) is a chemical compound with the molecular formula C17H23BrN2O3 and a molecular weight of 383.3 g/mol. IUPAC name: tert-butyl 4-[2-(4-bromophenyl)-2-oxoethyl]piperazine-1-carboxylate. InChIKey: ARWWJZJCXZYSSE-UHFFFAOYSA-N.
| Molecular formula | C17H23BrN2O3 |
|---|---|
| Molecular weight | 383.3 g/mol |
| IUPAC name | tert-butyl 4-[2-(4-bromophenyl)-2-oxoethyl]piperazine-1-carboxylate |
| InChIKey | ARWWJZJCXZYSSE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)