Products 2197427-85-1

CAS 2197427-85-1 is the registry number for 2-(4-Bromo-benzylcarbamoyl)-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[(4-bromophenyl)methylcarbamoyl]pyrrolidine-1-carboxylate (CAS 2197427-85-1) is a chemical compound with the molecular formula C17H23BrN2O3 and a molecular weight of 383.3 g/mol. IUPAC name: tert-butyl 2-[(4-bromophenyl)methylcarbamoyl]pyrrolidine-1-carboxylate. InChIKey: QEZWSZVDCPIXLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H23BrN2O3
Molecular weight383.3 g/mol
IUPAC nametert-butyl 2-[(4-bromophenyl)methylcarbamoyl]pyrrolidine-1-carboxylate
InChIKeyQEZWSZVDCPIXLZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC1C(=O)NCC2=CC=C(C=C2)Br

Computed by PubChem (NCBI)