Products 1291625-07-4
CAS 1291625-07-4 is the registry number for N-(2-(1H-Pyrazol-1-yl)ethyl)benzo[d]oxazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-pyrazol-1-ylethyl)-1,3-benzoxazol-2-amine (CAS 1291625-07-4) is a chemical compound with the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. IUPAC name: N-(2-pyrazol-1-ylethyl)-1,3-benzoxazol-2-amine. InChIKey: UGJCKQFSAIXTKX-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | N-(2-pyrazol-1-ylethyl)-1,3-benzoxazol-2-amine |
| InChIKey | UGJCKQFSAIXTKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)NCCN3C=CC=N3 |
Computed by PubChem (NCBI)