CAS 1858251-88-3 is the registry number for 2-Azido-1-(1,2-dimethyl-1H-indol-3-yl)ethanone. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
2-azido-1-(1,2-dimethylindol-3-yl)ethanone (CAS 1858251-88-3) is a chemical compound with the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. IUPAC name: 2-azido-1-(1,2-dimethylindol-3-yl)ethanone. InChIKey: SBVWRAIVDXGTMN-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 2-azido-1-(1,2-dimethylindol-3-yl)ethanone |
| InChIKey | SBVWRAIVDXGTMN-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1C)C(=O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)