CAS 1291723-68-6 is the registry number for 1-{(4-(Trifluoromethyl)phenyl)methyl}-1H-1,2,4-triazol-3-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazol-3-amine (CAS 1291723-68-6) is a chemical compound with the molecular formula C10H9F3N4 and a molecular weight of 242.20 g/mol. IUPAC name: 1-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazol-3-amine. InChIKey: IMHLRERCCAYEFX-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N4 |
|---|---|
| Molecular weight | 242.20 g/mol |
| IUPAC name | 1-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazol-3-amine |
| InChIKey | IMHLRERCCAYEFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC(=N2)N)C(F)(F)F |
Computed by PubChem (NCBI)