CAS 926234-78-8 appears in our catalog under these names: 3-Methyl-1-(5-(trifluoromethyl)pyridin-2-yl)-1H-pyrazol-5-amine, 95%, 3-Methyl-1-(5-(trifluoromethyl)pyridin-2-yl)-1H-pyrazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
5-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-3-amine (CAS 926234-78-8) is a chemical compound with the molecular formula C10H9F3N4 and a molecular weight of 242.20 g/mol. IUPAC name: 5-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-3-amine. InChIKey: KSEPDTCKJCJYGY-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N4 |
|---|---|
| Molecular weight | 242.20 g/mol |
| IUPAC name | 5-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-3-amine |
| InChIKey | KSEPDTCKJCJYGY-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)N)C2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)