CAS 1291958-63-8 appears in our catalog under these names: 1-(2-(2-Chloro-4-formylphenoxy)ethyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 1-(2-(2-Chloro-4-formylphenoxy)ethyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[2-(2-chloro-4-formylphenoxy)ethyl]triazole-4-carboxylic acid (CAS 1291958-63-8) is a chemical compound with the molecular formula C12H10ClN3O4 and a molecular weight of 295.68 g/mol. IUPAC name: 1-[2-(2-chloro-4-formylphenoxy)ethyl]triazole-4-carboxylic acid. InChIKey: NRTZROABHGJTIY-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O4 |
|---|---|
| Molecular weight | 295.68 g/mol |
| IUPAC name | 1-[2-(2-chloro-4-formylphenoxy)ethyl]triazole-4-carboxylic acid |
| InChIKey | NRTZROABHGJTIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)Cl)OCCN2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)