CAS 514801-13-9 is the registry number for 3-((4-Chloro-3-nitro-1H-pyrazol-1-yl)methyl)-4-methoxybenzaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxybenzaldehyde (CAS 514801-13-9) is a chemical compound with the molecular formula C12H10ClN3O4 and a molecular weight of 295.68 g/mol. IUPAC name: 3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxybenzaldehyde. InChIKey: FPUKYFGGQDBCGS-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O4 |
|---|---|
| Molecular weight | 295.68 g/mol |
| IUPAC name | 3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxybenzaldehyde |
| InChIKey | FPUKYFGGQDBCGS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C=O)CN2C=C(C(=N2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)