CAS 129221-76-7 is the registry number for 3-Formylbenzene-1,2-dicarbonitrile. Offered by: TRC. Available pack sizes: 500mg.
3-formylbenzene-1,2-dicarbonitrile (CAS 129221-76-7) is a chemical compound with the molecular formula C9H4N2O and a molecular weight of 156.14 g/mol. IUPAC name: 3-formylbenzene-1,2-dicarbonitrile. InChIKey: ZIMDAKBCOAZMNT-UHFFFAOYSA-N.
| Molecular formula | C9H4N2O |
|---|---|
| Molecular weight | 156.14 g/mol |
| IUPAC name | 3-formylbenzene-1,2-dicarbonitrile |
| InChIKey | ZIMDAKBCOAZMNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C#N)C#N)C=O |
Computed by PubChem (NCBI)