CAS 159618-36-7 appears in our catalog under these names: 2,6-Dicyanobenzaldehyde, 98%, 2-Formylisophthalonitrile, 97%, 2–Formylisophthalonitrile. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
2-formylbenzene-1,3-dicarbonitrile (CAS 159618-36-7) is a chemical compound with the molecular formula C9H4N2O and a molecular weight of 156.14 g/mol. IUPAC name: 2-formylbenzene-1,3-dicarbonitrile. InChIKey: UYKUDVMGMZDHMR-UHFFFAOYSA-N.
| Molecular formula | C9H4N2O |
|---|---|
| Molecular weight | 156.14 g/mol |
| IUPAC name | 2-formylbenzene-1,3-dicarbonitrile |
| InChIKey | UYKUDVMGMZDHMR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C#N)C=O)C#N |
Computed by PubChem (NCBI)