Products 129245-21-2

CAS 129245-21-2 is the registry number for Deferoxamine Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(5-aminopentyl)-N-phenylmethoxycarbamate (CAS 129245-21-2) is a chemical compound with the molecular formula C17H28N2O3 and a molecular weight of 308.4 g/mol. IUPAC name: tert-butyl N-(5-aminopentyl)-N-phenylmethoxycarbamate. InChIKey: DHJOLNKVLZRNGD-UHFFFAOYSA-N.

Identity
Molecular formulaC17H28N2O3
Molecular weight308.4 g/mol
IUPAC nametert-butyl N-(5-aminopentyl)-N-phenylmethoxycarbamate
InChIKeyDHJOLNKVLZRNGD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(CCCCCN)OCC1=CC=CC=C1

Computed by PubChem (NCBI)