CAS 184177-88-6 appears in our catalog under these names: Posaconazole Impurity 109, (S-(R*,R*))-2-(1-ethyl-2-(phenylmethoxy)propyl)-1,1-dimethylethyl Ester Hydrazinecarboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
Tert-butyl N-[[(2S,3S)-2-phenylmethoxypentan-3-yl]amino]carbamate (CAS 184177-88-6) is a chemical compound with the molecular formula C17H28N2O3 and a molecular weight of 308.4 g/mol. IUPAC name: tert-butyl N-[[(2S,3S)-2-phenylmethoxypentan-3-yl]amino]carbamate. InChIKey: IJLZRIHVBSTUSD-ZFWWWQNUSA-N.
| Molecular formula | C17H28N2O3 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | tert-butyl N-[[(2S,3S)-2-phenylmethoxypentan-3-yl]amino]carbamate |
| InChIKey | IJLZRIHVBSTUSD-ZFWWWQNUSA-N |
| SMILES | CC[C@@H]([C@H](C)OCC1=CC=CC=C1)NNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)