Products 1292766-21-2
CAS 1292766-21-2 is the registry number for Pierreione B. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 1 mg, 5 mg.
Pierreione B is a methoxyisoflavone that is isoflavone substituted by a methoxy group at position 3', a 2R,3-dihydroxy-3-methylbutoxyl group at position 4' and a dimethylpyran ring fused across positions 6 and 7. Isolated from Antheroporum pierrei, it exhibits antineoplastic activity. It has a role as a metabolite, an antineoplastic agent and a plant metabolite.
Source: ChEBI
| Molecular formula | C26H28O7 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | 7-[4-[(2R)-2,3-dihydroxy-3-methylbutoxy]-3-methoxyphenyl]-2,2-dimethylpyrano[3,2-g]chromen-6-one |
| InChIKey | RDXLWAJRBPKMPD-HSZRJFAPSA-N |
| SMILES | CC1(C=CC2=CC3=C(C=C2O1)OC=C(C3=O)C4=CC(=C(C=C4)OC[C@H](C(C)(C)O)O)OC)C |
Computed by PubChem (NCBI)
Synonyms:
Pierreione B, orb1681894