Products 137217-88-0
CAS 137217-88-0 is the registry number for 6'-Prenylpiscidone. Offered by: Biosynth. Available pack sizes: 1mg, 2mg, 5mg.
3-[3,4-dihydroxy-5-methoxy-2,6-bis(3-methylbut-2-enyl)phenyl]-5,7-dihydroxychromen-4-one (CAS 137217-88-0) is a chemical compound with the molecular formula C26H28O7 and a molecular weight of 452.5 g/mol. IUPAC name: 3-[3,4-dihydroxy-5-methoxy-2,6-bis(3-methylbut-2-enyl)phenyl]-5,7-dihydroxychromen-4-one. InChIKey: QRBBKWLOIYMFQP-UHFFFAOYSA-N.
| Molecular formula | C26H28O7 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | 3-[3,4-dihydroxy-5-methoxy-2,6-bis(3-methylbut-2-enyl)phenyl]-5,7-dihydroxychromen-4-one |
| InChIKey | QRBBKWLOIYMFQP-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=C(C(=C1O)O)OC)CC=C(C)C)C2=COC3=CC(=CC(=C3C2=O)O)O)C |
Computed by PubChem (NCBI)