CAS 1293284-60-2 appears in our catalog under these names: 2-Fluoro-6-(pyrimidin-2-yl)benzoic acid, 2-Fluoro-6-(pyrimidin-2-yl)benzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 50mg, 0,5g, 1g, 5g.
2-fluoro-6-pyrimidin-2-ylbenzoic acid (CAS 1293284-60-2) is a chemical compound with the molecular formula C11H7FN2O2 and a molecular weight of 218.18 g/mol. IUPAC name: 2-fluoro-6-pyrimidin-2-ylbenzoic acid. InChIKey: NEWFEFODKLAVHC-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O2 |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | 2-fluoro-6-pyrimidin-2-ylbenzoic acid |
| InChIKey | NEWFEFODKLAVHC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)O)C2=NC=CC=N2 |
Computed by PubChem (NCBI)