Products 129385-60-0
CAS 129385-60-0 appears in our catalog under these names: Asenapine Impurity 2, Asenapine Impurity 15, 2,3,3a,12b-Tetradehydro Asenapine, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
9-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7(12),8,10,14,16-octaene (CAS 129385-60-0) is a chemical compound with the molecular formula C17H12ClNO and a molecular weight of 281.7 g/mol. IUPAC name: 9-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7(12),8,10,14,16-octaene. InChIKey: SGWOPWVMYXQVHJ-UHFFFAOYSA-N.
| Molecular formula | C17H12ClNO |
|---|---|
| Molecular weight | 281.7 g/mol |
| IUPAC name | 9-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7(12),8,10,14,16-octaene |
| InChIKey | SGWOPWVMYXQVHJ-UHFFFAOYSA-N |
| SMILES | CN1C=C2C3=CC=CC=C3OC4=C(C2=C1)C=C(C=C4)Cl |
Computed by PubChem (NCBI)