Products 883526-10-1

CAS 883526-10-1 is the registry number for 2-(2-Methylphenyl)quinoline-4-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2-methylphenyl)quinoline-4-carbonyl chloride (CAS 883526-10-1) is a chemical compound with the molecular formula C17H12ClNO and a molecular weight of 281.7 g/mol. IUPAC name: 2-(2-methylphenyl)quinoline-4-carbonyl chloride. InChIKey: YHRHRVSOOAHNFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12ClNO
Molecular weight281.7 g/mol
IUPAC name2-(2-methylphenyl)quinoline-4-carbonyl chloride
InChIKeyYHRHRVSOOAHNFQ-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1C2=NC3=CC=CC=C3C(=C2)C(=O)Cl

Computed by PubChem (NCBI)