CAS 1294048-82-0 appears in our catalog under these names: Thiamethoxam-d3, Thiamethoxam-d3, >95% (HPLC), Thiamethoxam D3 (methyl D3), Thiamethoxam-d3 (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, Thiamethoxam–d3. Offered by: Hubei YoungXin, TRC, Dr. Ehrenstorfer, CDN, TargetMol. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 0,01g.
(NZ)-N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-(trideuteriomethyl)-1,3,5-oxadiazinan-4-ylidene]nitramide (CAS 1294048-82-0) is a chemical compound with the molecular formula C8H10ClN5O3S and a molecular weight of 294.73 g/mol. IUPAC name: (NZ)-N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-(trideuteriomethyl)-1,3,5-oxadiazinan-4-ylidene]nitramide. InChIKey: NWWZPOKUUAIXIW-FVFGAQAMSA-N.
| Molecular formula | C8H10ClN5O3S |
|---|---|
| Molecular weight | 294.73 g/mol |
| IUPAC name | (NZ)-N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-(trideuteriomethyl)-1,3,5-oxadiazinan-4-ylidene]nitramide |
| InChIKey | NWWZPOKUUAIXIW-FVFGAQAMSA-N |
| SMILES | [2H]C([2H])([2H])N\1COCN(/C1=N\[N+](=O)[O-])CC2=CN=C(S2)Cl |
Computed by PubChem (NCBI)