CAS 1331642-98-8 appears in our catalog under these names: Thiamethoxam-d4, Thiamethoxam-d4, >95% (HPLC), Thiamethoxam D4 (oxadiazine D4), Thiamethoxam D4 (oxadiazine D4) 100 µg/mL in Acetone. Offered by: Hubei YoungXin, TRC, Dr. Ehrenstorfer, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 1ml, 25 mg.
N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2,6,6-tetradeuterio-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide (CAS 1331642-98-8) is a chemical compound with the molecular formula C8H10ClN5O3S and a molecular weight of 295.74 g/mol. IUPAC name: N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2,6,6-tetradeuterio-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide. InChIKey: NWWZPOKUUAIXIW-CQOLUAMGSA-N.
| Molecular formula | C8H10ClN5O3S |
|---|---|
| Molecular weight | 295.74 g/mol |
| IUPAC name | N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2,2,6,6-tetradeuterio-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide |
| InChIKey | NWWZPOKUUAIXIW-CQOLUAMGSA-N |
| SMILES | [2H]C1(N(C(=N[N+](=O)[O-])N(C(O1)([2H])[2H])CC2=CN=C(S2)Cl)C)[2H] |
Computed by PubChem (NCBI)