Products 1294496-79-9
CAS 1294496-79-9 appears in our catalog under these names: 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoic acid, 95%, 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoic acid, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 500mg, 1g, 5g, 10g, 25g.
5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoic acid (CAS 1294496-79-9) is a chemical compound with the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. IUPAC name: 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoic acid. InChIKey: REJCGLKEAYCTFE-UHFFFAOYSA-N.
| Molecular formula | C14H16F3NO3 |
|---|---|
| Molecular weight | 303.28 g/mol |
| IUPAC name | 5-[(2,2-dimethylpropanoylamino)methyl]-2-(trifluoromethyl)benzoic acid |
| InChIKey | REJCGLKEAYCTFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NCC1=CC(=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)