Products 1875533-29-1
CAS 1875533-29-1 is the registry number for tert-Butyl 3-hydroxy-3-(2,3,5-trifluorophenyl)azetidine-1-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-hydroxy-3-(2,3,5-trifluorophenyl)azetidine-1-carboxylate (CAS 1875533-29-1) is a chemical compound with the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. IUPAC name: tert-butyl 3-hydroxy-3-(2,3,5-trifluorophenyl)azetidine-1-carboxylate. InChIKey: IMIFDJOVLVRGFL-UHFFFAOYSA-N.
| Molecular formula | C14H16F3NO3 |
|---|---|
| Molecular weight | 303.28 g/mol |
| IUPAC name | tert-butyl 3-hydroxy-3-(2,3,5-trifluorophenyl)azetidine-1-carboxylate |
| InChIKey | IMIFDJOVLVRGFL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C2=C(C(=CC(=C2)F)F)F)O |
Computed by PubChem (NCBI)