CAS 129454-96-2 is the registry number for Tretinoin Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
(2E,4E,6E)-7-(5,5,8a-trimethyl-3,6,7,8-tetrahydro-1,2-benzodioxin-3-yl)-3-methylocta-2,4,6-trienoic acid (CAS 129454-96-2) is a chemical compound with the molecular formula C20H28O4 and a molecular weight of 332.4 g/mol. IUPAC name: (2E,4E,6E)-7-(5,5,8a-trimethyl-3,6,7,8-tetrahydro-1,2-benzodioxin-3-yl)-3-methylocta-2,4,6-trienoic acid. InChIKey: QCBHAKOQLSSZNZ-JUPVTLSTSA-N.
| Molecular formula | C20H28O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | (2E,4E,6E)-7-(5,5,8a-trimethyl-3,6,7,8-tetrahydro-1,2-benzodioxin-3-yl)-3-methylocta-2,4,6-trienoic acid |
| InChIKey | QCBHAKOQLSSZNZ-JUPVTLSTSA-N |
| SMILES | C/C(=C\C(=O)O)/C=C/C=C(\C)/C1C=C2C(CCCC2(OO1)C)(C)C |
Computed by PubChem (NCBI)