CAS 64924-07-8 appears in our catalog under these names: Cannabigerovarinic Acid, Cannabigerovarinic Acid, CANNABIGEROVARINIC ACID (CBGVA). Offered by: Chemat Brand, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 1mg, 500μg, 1ML, 1 mg, 500 μg.
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-propylbenzoic acid (CAS 64924-07-8) is a chemical compound with the molecular formula C20H28O4 and a molecular weight of 332.4 g/mol. IUPAC name: 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-propylbenzoic acid. InChIKey: FAVCTJGKHFHFHJ-GXDHUFHOSA-N.
| Molecular formula | C20H28O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-propylbenzoic acid |
| InChIKey | FAVCTJGKHFHFHJ-GXDHUFHOSA-N |
| SMILES | CCCC1=CC(=C(C(=C1C(=O)O)O)C/C=C(\C)/CCC=C(C)C)O |
Computed by PubChem (NCBI)