Products 129460-13-5
CAS 129460-13-5 appears in our catalog under these names: Fmoc-Thr(OtBu)-OtBu, 96%, 96%, Fmoc-Thr(OtBu)-OtBu, 96.36%, Fmoc-Thr(OtBu)-OtBu, 96%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 50 mg, 100 mg, 25 mg, 1g.
Tert-butyl (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate (CAS 129460-13-5) is a chemical compound with the molecular formula C27H35NO5 and a molecular weight of 453.6 g/mol. IUPAC name: tert-butyl (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate. InChIKey: SMFKTJJKAKWVLO-HXOBKFHXSA-N.
| Molecular formula | C27H35NO5 |
|---|---|
| Molecular weight | 453.6 g/mol |
| IUPAC name | tert-butyl (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate |
| InChIKey | SMFKTJJKAKWVLO-HXOBKFHXSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C |
Computed by PubChem (NCBI)