CAS 2459446-53-6 is the registry number for Sacubitril Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2R,4S)-2-methyl-4-[(4-oxo-4-propan-2-yloxybutanoyl)amino]-5-(4-phenylphenyl)pentanoate (CAS 2459446-53-6) is a chemical compound with the molecular formula C27H35NO5 and a molecular weight of 453.6 g/mol. IUPAC name: ethyl (2R,4S)-2-methyl-4-[(4-oxo-4-propan-2-yloxybutanoyl)amino]-5-(4-phenylphenyl)pentanoate. InChIKey: MYOMFQNNYCRSJH-YKSBVNFPSA-N.
| Molecular formula | C27H35NO5 |
|---|---|
| Molecular weight | 453.6 g/mol |
| IUPAC name | ethyl (2R,4S)-2-methyl-4-[(4-oxo-4-propan-2-yloxybutanoyl)amino]-5-(4-phenylphenyl)pentanoate |
| InChIKey | MYOMFQNNYCRSJH-YKSBVNFPSA-N |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)OC(C)C |
Computed by PubChem (NCBI)