Products 129460-16-8
CAS 129460-16-8 appears in our catalog under these names: Fmoc-Ser(tBu)-OtBu, 99.32%, Fmoc-Ser(tBu)-OtBu, 98%. Offered by: MedChemExpress, Fluorochem. Available pack sizes: 50 mg, 100 mg, 25 mg, 100mg.
Tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate (CAS 129460-16-8) is a chemical compound with the molecular formula C26H33NO5 and a molecular weight of 439.5 g/mol. IUPAC name: tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate. InChIKey: NIUNLIWUZINRRV-QFIPXVFZSA-N.
| Molecular formula | C26H33NO5 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate |
| InChIKey | NIUNLIWUZINRRV-QFIPXVFZSA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)