Products 1428856-47-6
CAS 1428856-47-6 appears in our catalog under these names: Fesoterodine Diol Fumarate Ester, Fesoterodine Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-4-[[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxyphenyl]methoxy]-4-oxobut-2-enoic acid (CAS 1428856-47-6) is a chemical compound with the molecular formula C26H33NO5 and a molecular weight of 439.5 g/mol. IUPAC name: (E)-4-[[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxyphenyl]methoxy]-4-oxobut-2-enoic acid. InChIKey: IVTSSNHDPALXLL-CHHLAKQQSA-N.
| Molecular formula | C26H33NO5 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (E)-4-[[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxyphenyl]methoxy]-4-oxobut-2-enoic acid |
| InChIKey | IVTSSNHDPALXLL-CHHLAKQQSA-N |
| SMILES | CC(C)N(CC[C@H](C1=CC=CC=C1)C2=C(C=CC(=C2)COC(=O)/C=C/C(=O)O)O)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
Fesoterodine Diol Fumarate Ester