CAS 129672-23-7 appears in our catalog under these names: N-Desmethyl Ecopipam, Sch 40853. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(6aR,13bS)-11-chloro-6,6a,7,8,9,13b-hexahydro-5H-naphtho[1,2-a][3]benzazepin-12-ol (CAS 129672-23-7) is a chemical compound with the molecular formula C18H18ClNO and a molecular weight of 299.8 g/mol. IUPAC name: (6aR,13bS)-11-chloro-6,6a,7,8,9,13b-hexahydro-5H-naphtho[1,2-a][3]benzazepin-12-ol. InChIKey: NVHUFRKDLSFBFZ-AEFFLSMTSA-N.
| Molecular formula | C18H18ClNO |
|---|---|
| Molecular weight | 299.8 g/mol |
| IUPAC name | (6aR,13bS)-11-chloro-6,6a,7,8,9,13b-hexahydro-5H-naphtho[1,2-a][3]benzazepin-12-ol |
| InChIKey | NVHUFRKDLSFBFZ-AEFFLSMTSA-N |
| SMILES | C1CC2=CC=CC=C2[C@@H]3[C@@H]1NCCC4=CC(=C(C=C34)O)Cl |
Computed by PubChem (NCBI)