Products 736173-19-6
CAS 736173-19-6 appears in our catalog under these names: 2-(Amino-p-tolyl-methyl)-naphthalen-1-ol hydrochloride, 95%, 2-(Amino(p-tolyl)methyl)naphthalen-1-ol hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
2-[amino-(4-methylphenyl)methyl]naphthalen-1-ol;hydrochloride (CAS 736173-19-6) is a chemical compound with the molecular formula C18H18ClNO and a molecular weight of 299.8 g/mol. IUPAC name: 2-[amino-(4-methylphenyl)methyl]naphthalen-1-ol;hydrochloride. InChIKey: BHZWVMQXKHALIB-UHFFFAOYSA-N.
| Molecular formula | C18H18ClNO |
|---|---|
| Molecular weight | 299.8 g/mol |
| IUPAC name | 2-[amino-(4-methylphenyl)methyl]naphthalen-1-ol;hydrochloride |
| InChIKey | BHZWVMQXKHALIB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=C(C3=CC=CC=C3C=C2)O)N.Cl |
Computed by PubChem (NCBI)