Products 129673-86-5
CAS 129673-86-5 appears in our catalog under these names: 3–Hydroxybisabola–1，10–dien–9–one, 3-Hydroxybisabola-1,10-dien-9-one. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
(6S)-6-[(1R,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-en-4-one (CAS 129673-86-5) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: (6S)-6-[(1R,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-en-4-one. InChIKey: OZDOAMOSJAOPRV-GUTXKFCHSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | (6S)-6-[(1R,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-en-4-one |
| InChIKey | OZDOAMOSJAOPRV-GUTXKFCHSA-N |
| SMILES | C[C@@H](CC(=O)C=C(C)C)[C@H]1CC[C@@](C=C1)(C)O |
Computed by PubChem (NCBI)