CAS 129724-42-1 is the registry number for Melafolone. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2,4-dihydroxy-3,6-dimethoxy-5-[(E)-3-phenylprop-2-enoyl]phenyl] 2-methylbutanoate (CAS 129724-42-1) is a chemical compound with the molecular formula C22H24O7 and a molecular weight of 400.4 g/mol. IUPAC name: [2,4-dihydroxy-3,6-dimethoxy-5-[(E)-3-phenylprop-2-enoyl]phenyl] 2-methylbutanoate. InChIKey: BICSVVFMOSJUCU-VAWYXSNFSA-N.
| Molecular formula | C22H24O7 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | [2,4-dihydroxy-3,6-dimethoxy-5-[(E)-3-phenylprop-2-enoyl]phenyl] 2-methylbutanoate |
| InChIKey | BICSVVFMOSJUCU-VAWYXSNFSA-N |
| SMILES | CCC(C)C(=O)OC1=C(C(=C(C(=C1O)OC)O)C(=O)/C=C/C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)