Products 173792-49-9
CAS 173792-49-9 is the registry number for Brevicornin. Offered by: MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg.
3,5,7-trihydroxy-8-(3-methoxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one (CAS 173792-49-9) is a chemical compound with the molecular formula C22H24O7 and a molecular weight of 400.4 g/mol. IUPAC name: 3,5,7-trihydroxy-8-(3-methoxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one. InChIKey: YUCRNUHJPUHOKK-UHFFFAOYSA-N.
| Molecular formula | C22H24O7 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | 3,5,7-trihydroxy-8-(3-methoxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | YUCRNUHJPUHOKK-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC1=C2C(=C(C=C1O)O)C(=O)C(=C(O2)C3=CC=C(C=C3)OC)O)OC |
Computed by PubChem (NCBI)