CAS 129740-14-3 is the registry number for (S)-tert-Butyl azetidine-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl (2S)-azetidine-2-carboxylate (CAS 129740-14-3) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: tert-butyl (2S)-azetidine-2-carboxylate. InChIKey: KHNFEQCEQIAFES-LURJTMIESA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | tert-butyl (2S)-azetidine-2-carboxylate |
| InChIKey | KHNFEQCEQIAFES-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCN1 |
Computed by PubChem (NCBI)