CAS 1298022-53-3 is the registry number for Bilastine impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(4-ethenylphenyl)propan-2-yl]-4,4-dimethyl-5H-1,3-oxazole (CAS 1298022-53-3) is a chemical compound with the molecular formula C16H21NO and a molecular weight of 243.34 g/mol. IUPAC name: 2-[2-(4-ethenylphenyl)propan-2-yl]-4,4-dimethyl-5H-1,3-oxazole. InChIKey: CTXIAZQUMATWBR-UHFFFAOYSA-N.
| Molecular formula | C16H21NO |
|---|---|
| Molecular weight | 243.34 g/mol |
| IUPAC name | 2-[2-(4-ethenylphenyl)propan-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | CTXIAZQUMATWBR-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C(C)(C)C2=CC=C(C=C2)C=C)C |
Computed by PubChem (NCBI)