Products 873691-34-0
CAS 873691-34-0 is the registry number for N-Desmethyl Dextrorphan-d3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
3,5,6-trideuterio-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (CAS 873691-34-0) is a chemical compound with the molecular formula C16H21NO and a molecular weight of 246.36 g/mol. IUPAC name: 3,5,6-trideuterio-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol. InChIKey: IYNWSQDZXMGGGI-IKZWUOANSA-N.
| Molecular formula | C16H21NO |
|---|---|
| Molecular weight | 246.36 g/mol |
| IUPAC name | 3,5,6-trideuterio-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| InChIKey | IYNWSQDZXMGGGI-IKZWUOANSA-N |
| SMILES | [2H]C1=C(C(=C(C2=C1CC3C4C2(CCCC4)CCN3)[2H])O)[2H] |
Computed by PubChem (NCBI)