CAS 129808-00-0 appears in our catalog under these names: 4,4'-(Ethyne-1,2-diyl)diphthalic anhydride, 95%, 4,4'–(Ethyne–1,2–diyl)diphthalic anhydride, 4,4'-(Ethyne-1,2-diyl)diphthalic Anhydride, >98.0%(HPLC)(T), 4,4'-(Ethyne-1,2-diyl)diphthalic Anhydride (purified by sublimation), >99.0%(T)(HPLC), 4,4'-(Ethyne-1,2-diyl)diphthalic Anhydride, ≥98%(HPLC)(T), ≥98%(HPLC)(T). Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 25g.
5-[2-(1,3-dioxo-2-benzofuran-5-yl)ethynyl]-2-benzofuran-1,3-dione (CAS 129808-00-0) is a chemical compound with the molecular formula C18H6O6 and a molecular weight of 318.2 g/mol. IUPAC name: 5-[2-(1,3-dioxo-2-benzofuran-5-yl)ethynyl]-2-benzofuran-1,3-dione. InChIKey: XGZRRDYHYZLYIJ-UHFFFAOYSA-N.
| Molecular formula | C18H6O6 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 5-[2-(1,3-dioxo-2-benzofuran-5-yl)ethynyl]-2-benzofuran-1,3-dione |
| InChIKey | XGZRRDYHYZLYIJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#CC3=CC4=C(C=C3)C(=O)OC4=O)C(=O)OC2=O |
Computed by PubChem (NCBI)