CAS 1807793-22-1 is the registry number for Triphenylene-2,3,6,7,10,11-hexaone, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Triphenylene-2,3,6,7,10,11-hexone (CAS 1807793-22-1) is a chemical compound with the molecular formula C18H6O6 and a molecular weight of 318.2 g/mol. IUPAC name: triphenylene-2,3,6,7,10,11-hexone. InChIKey: CVDALFASPVBUKU-UHFFFAOYSA-N.
| Molecular formula | C18H6O6 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | triphenylene-2,3,6,7,10,11-hexone |
| InChIKey | CVDALFASPVBUKU-UHFFFAOYSA-N |
| SMILES | C1=C2C3=CC(=O)C(=O)C=C3C4=CC(=O)C(=O)C=C4C2=CC(=O)C1=O |
Computed by PubChem (NCBI)