CAS 129864-97-7 appears in our catalog under these names: (2S,3S,4R,5R,6S)-2-fluoro-6-methyltetrahydro-2H-pyran-3,4,5-triyl triacetate, 98%, (2S,3S,4R,5R,6S)–2–fluoro–6–methyltetrahydro–2H–pyran–3,4,5–triyl triacetate, 2,3,4-Tri-O-acetyl-α-L-fucopyranosyl fluoride. Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
[(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-fluoro-2-methyloxan-3-yl] acetate (CAS 129864-97-7) is a chemical compound with the molecular formula C12H17FO7 and a molecular weight of 292.26 g/mol. IUPAC name: [(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-fluoro-2-methyloxan-3-yl] acetate. InChIKey: SAOYKKJFCIMXDB-BSOOIWJMSA-N.
| Molecular formula | C12H17FO7 |
|---|---|
| Molecular weight | 292.26 g/mol |
| IUPAC name | [(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-fluoro-2-methyloxan-3-yl] acetate |
| InChIKey | SAOYKKJFCIMXDB-BSOOIWJMSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)F)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)