CAS 74554-12-4 appears in our catalog under these names: (2S,3S,4R,5R,6S)–3–fluoro–6–methyltetrahydro–2H–pyran–2,4,5–triyl triacetate, 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-α-L-fucopyranose. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 5mg.
[(3R,4S,6S)-4,6-diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate (CAS 74554-12-4) is a chemical compound with the molecular formula C12H17FO7 and a molecular weight of 292.26 g/mol. IUPAC name: [(3R,4S,6S)-4,6-diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate. InChIKey: QFVJLBVULJFLKN-MMMLBONTSA-N.
| Molecular formula | C12H17FO7 |
|---|---|
| Molecular weight | 292.26 g/mol |
| IUPAC name | [(3R,4S,6S)-4,6-diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate |
| InChIKey | QFVJLBVULJFLKN-MMMLBONTSA-N |
| SMILES | CC1[C@H]([C@@H](C([C@@H](O1)OC(=O)C)F)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)