CAS 1299483-40-1 appears in our catalog under these names: (4-Bromo-2-trifluoromethyl-benzyl)-carbamic acid tert-butyl ester, 95%, tert-Butyl (4-bromo-2-(trifluoromethyl)benzyl)carbamate, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Tert-butyl N-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]carbamate (CAS 1299483-40-1) is a chemical compound with the molecular formula C13H15BrF3NO2 and a molecular weight of 354.16 g/mol. IUPAC name: tert-butyl N-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]carbamate. InChIKey: XNMRQRVXZUVBSK-UHFFFAOYSA-N.
| Molecular formula | C13H15BrF3NO2 |
|---|---|
| Molecular weight | 354.16 g/mol |
| IUPAC name | tert-butyl N-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]carbamate |
| InChIKey | XNMRQRVXZUVBSK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)