CAS 2270911-05-0 is the registry number for 5-Bromo-n,n-diethyl-2-(2,2,2-trifluoro-ethoxy)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-bromo-N,N-diethyl-2-(2,2,2-trifluoroethoxy)benzamide (CAS 2270911-05-0) is a chemical compound with the molecular formula C13H15BrF3NO2 and a molecular weight of 354.16 g/mol. IUPAC name: 5-bromo-N,N-diethyl-2-(2,2,2-trifluoroethoxy)benzamide. InChIKey: IFOKEXDYXKRCSY-UHFFFAOYSA-N.
| Molecular formula | C13H15BrF3NO2 |
|---|---|
| Molecular weight | 354.16 g/mol |
| IUPAC name | 5-bromo-N,N-diethyl-2-(2,2,2-trifluoroethoxy)benzamide |
| InChIKey | IFOKEXDYXKRCSY-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=CC(=C1)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)