CAS 129973-75-7 appears in our catalog under these names: N-Desmethyl Clobazam-d5, >95% (HPLC), N-Desmethyl Clobazam-d5 (0.5mg/mL in Methanol), N-Desmethyl Clobazam-d5 (0.1mg/ml in Acetonitrile). Offered by: TRC. Available pack sizes: 10mg, 1mg, 1x1ml.
7-chloro-5-(2,3,4,5,6-pentadeuteriophenyl)-1H-1,5-benzodiazepine-2,4-dione (CAS 129973-75-7) is a chemical compound with the molecular formula C15H11ClN2O2 and a molecular weight of 291.74 g/mol. IUPAC name: 7-chloro-5-(2,3,4,5,6-pentadeuteriophenyl)-1H-1,5-benzodiazepine-2,4-dione. InChIKey: RRTVVRIFVKKTJK-RALIUCGRSA-N.
| Molecular formula | C15H11ClN2O2 |
|---|---|
| Molecular weight | 291.74 g/mol |
| IUPAC name | 7-chloro-5-(2,3,4,5,6-pentadeuteriophenyl)-1H-1,5-benzodiazepine-2,4-dione |
| InChIKey | RRTVVRIFVKKTJK-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N2C(=O)CC(=O)NC3=C2C=C(C=C3)Cl)[2H])[2H] |
Computed by PubChem (NCBI)