CAS 70988-37-3 is the registry number for Chlordiazepoxide Impurity D. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-4-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one (CAS 70988-37-3) is a chemical compound with the molecular formula C15H11ClN2O2 and a molecular weight of 286.71 g/mol. IUPAC name: 7-chloro-4-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one. InChIKey: PSADRZMLSXCSAS-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O2 |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | 7-chloro-4-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one |
| InChIKey | PSADRZMLSXCSAS-UHFFFAOYSA-N |
| SMILES | C1C(=O)N=C2C=CC(=CC2=C(N1O)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)