CAS 130-14-3 appears in our catalog under these names: Sodium 1–naphthalenesulfonate, Naphthalene-1-sulfonic acid sodium salt, 98% (dry wt.), wate, Sodium 1-Naphthalenesulfonate, >98.0%(HPLC)(T), Sodium 1-naphthalenesulfonate, Sodium naphthalene-1-sulfonate 85%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Ambeed. Available pack sizes: 100g, 500g, 5g, 25g, 5kg, 2kg, 10kg, 1000g.
Sodium naphthalene-1-sulfonate (CAS 130-14-3) is a chemical compound with the molecular formula C10H7NaO3S and a molecular weight of 230.22 g/mol. IUPAC name: sodium naphthalene-1-sulfonate. InChIKey: HIEHAIZHJZLEPQ-UHFFFAOYSA-M.
| Molecular formula | C10H7NaO3S |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | sodium naphthalene-1-sulfonate |
| InChIKey | HIEHAIZHJZLEPQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C=CC=C2S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)