CAS 532-02-5 appears in our catalog under these names: 2–Naphthalenesulfonic acid (sodium salt), Naphthalene-2-sulfonic acid sodium salt, 98%, may cont. up t, Sodium 2-Naphthalenesulfonate, >98.0%(HPLC)(T), Sodium 2-naphthalenesulfonate, Naphthalene-2-sulfonic acid sodium salt, Ion pair chromatography. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat, Thermo Scientific (Fisher). Available pack sizes: 100g, 10g, 1g, 25g, 5g, 1000g, 250g, 500g.
Sodium naphthalene-2-sulfonate (CAS 532-02-5) is a chemical compound with the molecular formula C10H7NaO3S and a molecular weight of 230.22 g/mol. IUPAC name: sodium naphthalene-2-sulfonate. InChIKey: YWPOLRBWRRKLMW-UHFFFAOYSA-M.
| Molecular formula | C10H7NaO3S |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | sodium naphthalene-2-sulfonate |
| InChIKey | YWPOLRBWRRKLMW-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)