Products 130-89-2
CAS 130-89-2 appears in our catalog under these names: Quinine hydrochloride, 97%, Quinine hydrochloride, Quinine Hydrochloride, >95% (HPLC), Quinine hydrochloride, Quinine HCl. Offered by: Combi-blocks, Dr. Ehrenstorfer, TRC, GLPBio, TargetMol. Available pack sizes: 500g, 25g, 5g, 100g, 1g, 100mg, 50mg, 10 g.
(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;hydrochloride (CAS 130-89-2) is a chemical compound with the molecular formula C20H25ClN2O2 and a molecular weight of 360.9 g/mol. IUPAC name: (R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;hydrochloride. InChIKey: LBSFSRMTJJPTCW-DSXUQNDKSA-N.
| Molecular formula | C20H25ClN2O2 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | (R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;hydrochloride |
| InChIKey | LBSFSRMTJJPTCW-DSXUQNDKSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@H]([C@@H]3C[C@@H]4CCN3C[C@@H]4C=C)O.Cl |
Computed by PubChem (NCBI)